About CID 22944770
CID 22944770 (PubChem CID 22944770) has the molecular formula C27H20AlN3O3+
and a molecular weight of 461.46 g/mol.
Molecular Properties
| Compound Name | CID 22944770 |
| PubChem CID | 22944770 |
| Molecular Formula | C27H20AlN3O3+ |
| Molecular Weight | 461.46 g/mol |
| Exact Mass | 461.13 |
| IUPAC Name | — |
| SMILES | [OH2+]c1cccc2cccnc12.c1cnc2c(O[Al]Oc3cccc4cccnc34)cccc2c1 |
| InChI | InChI=1S/3C9H7NO.Al/c3*11-8-5-1-3-7-4-2-6-10-9(7)8;/h3*1-6,11H;/q;;;+2/p-1 |
| InChIKey | BDIMQTGYPTUGNY-UHFFFAOYSA-M |
| XLogP | 5.45 |
| TPSA | 80.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 461.46 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze CID 22944770 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22944770?
The IUPAC name of CID 22944770 (CID 22944770) is not available.
What is the SMILES notation for CID 22944770?
The canonical SMILES for CID 22944770 is [OH2+]c1cccc2cccnc12.c1cnc2c(O[Al]Oc3cccc4cccnc34)cccc2c1.
What is the InChIKey of CID 22944770?
The InChIKey is BDIMQTGYPTUGNY-UHFFFAOYSA-M. The full InChI is InChI=1S/3C9H7NO.Al/c3*11-8-5-1-3-7-4-2-6-10-9(7)8;/h3*1-6,11H;/q;;;+2/p-1.
What are the key properties of CID 22944770?
CID 22944770 has a molecular weight of 461.46 g/mol, XLogP of 5.45, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22944770 is sourced from PubChem (CID 22944770), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).