C20H32O7 — CID 22944825
dimethyl 2,3,4-trimethyl-2-[2-(3-methyl-2,5-dioxooxolan-3-yl)ethyl]-4-propan-2-ylpentanedioate (PubChem CID 22944825) has the molecular formula C20H32O7 and a molecular weight of 384.47 g/mol. Its IUPAC name is dimethyl 2,3,4-trimethyl-2-[2-(3-methyl-2,5-dioxooxolan-3-yl)ethyl]-4-propan-2-ylpentanedioate.
| Compound Name | dimethyl 2,3,4-trimethyl-2-[2-(3-methyl-2,5-dioxooxolan-3-yl)ethyl]-4-propan-2-ylpentanedioate |
|---|---|
| PubChem CID | 22944825 |
| Molecular Formula | C20H32O7 |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.21 |
| IUPAC Name | dimethyl 2,3,4-trimethyl-2-[2-(3-methyl-2,5-dioxooxolan-3-yl)ethyl]-4-propan-2-ylpentanedioate |
| SMILES | COC(=O)C(C)(CCC1(C)CC(=O)OC1=O)C(C)C(C)(C(=O)OC)C(C)C |
| InChI | InChI=1S/C20H32O7/c1-12(2)20(6,17(24)26-8)13(3)19(5,16(23)25-7)10-9-18(4)11-14(21)27-15(18)22/h12-13H,9-11H2,1-8H3 |
| InChIKey | UCUYPXJBDQUZHT-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|