C13H16N4O2 — CID 22945751
4-(2-oxo-1,4-dihydropyrido[3,4-d]pyrimidin-3-yl)piperidine-1-carbaldehyde (PubChem CID 22945751) has the molecular formula C13H16N4O2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 4-(2-oxo-1,4-dihydropyrido[3,4-d]pyrimidin-3-yl)piperidine-1-carbaldehyde.
| Compound Name | 4-(2-oxo-1,4-dihydropyrido[3,4-d]pyrimidin-3-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 22945751 |
| Molecular Formula | C13H16N4O2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 4-(2-oxo-1,4-dihydropyrido[3,4-d]pyrimidin-3-yl)piperidine-1-carbaldehyde |
| SMILES | O=CN1CCC(N2Cc3ccncc3NC2=O)CC1 |
| InChI | InChI=1S/C13H16N4O2/c18-9-16-5-2-11(3-6-16)17-8-10-1-4-14-7-12(10)15-13(17)19/h1,4,7,9,11H,2-3,5-6,8H2,(H,15,19) |
| InChIKey | YIJWULLHDVKMAG-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|