C16H21N3O4 — CID 22945783
4-(6,7-dimethoxy-2-oxo-1,4-dihydroquinazolin-3-yl)piperidine-1-carbaldehyde (PubChem CID 22945783) has the molecular formula C16H21N3O4 and a molecular weight of 319.36 g/mol. Its IUPAC name is 4-(6,7-dimethoxy-2-oxo-1,4-dihydroquinazolin-3-yl)piperidine-1-carbaldehyde.
| Compound Name | 4-(6,7-dimethoxy-2-oxo-1,4-dihydroquinazolin-3-yl)piperidine-1-carbaldehyde |
|---|---|
| PubChem CID | 22945783 |
| Molecular Formula | C16H21N3O4 |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.15 |
| IUPAC Name | 4-(6,7-dimethoxy-2-oxo-1,4-dihydroquinazolin-3-yl)piperidine-1-carbaldehyde |
| SMILES | COc1cc2c(cc1OC)NC(=O)N(C1CCN(C=O)CC1)C2 |
| InChI | InChI=1S/C16H21N3O4/c1-22-14-7-11-9-19(12-3-5-18(10-20)6-4-12)16(21)17-13(11)8-15(14)23-2/h7-8,10,12H,3-6,9H2,1-2H3,(H,17,21) |
| InChIKey | AABUJOMIWFUBCQ-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|