About (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine
(3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine (PubChem CID 22946078) has the molecular formula C9H10ClN3O3S
and a molecular weight of 275.72 g/mol. Its IUPAC name is (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine.
Molecular Properties
| Compound Name | (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine |
| PubChem CID | 22946078 |
| Molecular Formula | C9H10ClN3O3S |
| Molecular Weight | 275.72 g/mol |
| Exact Mass | 275.01 |
| IUPAC Name | (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine |
| SMILES | O=[N+]([O-])/C=C1/COCCN1Cc1cnc(Cl)s1 |
| InChI | InChI=1S/C9H10ClN3O3S/c10-9-11-3-8(17-9)5-12-1-2-16-6-7(12)4-13(14)15/h3-4H,1-2,5-6H2/b7-4- |
| InChIKey | MSXFPAWKOMFQGS-DAXSKMNVSA-N |
| XLogP | 1.75 |
| TPSA | 68.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.72 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine?
The IUPAC name of (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine (CID 22946078) is (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine.
What is the SMILES notation for (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine?
The canonical SMILES for (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine is O=[N+]([O-])/C=C1/COCCN1Cc1cnc(Cl)s1.
What is the InChIKey of (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine?
The InChIKey is MSXFPAWKOMFQGS-DAXSKMNVSA-N. The full InChI is InChI=1S/C9H10ClN3O3S/c10-9-11-3-8(17-9)5-12-1-2-16-6-7(12)4-13(14)15/h3-4H,1-2,5-6H2/b7-4-.
What are the key properties of (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine?
(3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine has a molecular weight of 275.72 g/mol, XLogP of 1.75, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (3Z)-4-[(2-chloro-1,3-thiazol-5-yl)methyl]-3-(nitromethylidene)morpholine is sourced from PubChem (CID 22946078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).