C15H20O — CID 22946125
3,3,4,5,6,7-hexamethyl-2H-inden-1-one (PubChem CID 22946125) has the molecular formula C15H20O and a molecular weight of 216.32 g/mol. Its IUPAC name is 3,3,4,5,6,7-hexamethyl-2H-inden-1-one.
| Compound Name | 3,3,4,5,6,7-hexamethyl-2H-inden-1-one |
|---|---|
| PubChem CID | 22946125 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 3,3,4,5,6,7-hexamethyl-2H-inden-1-one |
| SMILES | Cc1c(C)c(C)c2c(c1C)C(=O)CC2(C)C |
| InChI | InChI=1S/C15H20O/c1-8-9(2)11(4)14-13(10(8)3)12(16)7-15(14,5)6/h7H2,1-6H3 |
| InChIKey | PJYCHPFLCCMETD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |