C13H15NO2 — CID 22946132
4,5,6,7,8-pentamethyl-2,3-benzoxazin-1-one (PubChem CID 22946132) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is 4,5,6,7,8-pentamethyl-2,3-benzoxazin-1-one.
| Compound Name | 4,5,6,7,8-pentamethyl-2,3-benzoxazin-1-one |
|---|---|
| PubChem CID | 22946132 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | 4,5,6,7,8-pentamethyl-2,3-benzoxazin-1-one |
| SMILES | Cc1c(C)c(C)c2c(=O)onc(C)c2c1C |
| InChI | InChI=1S/C13H15NO2/c1-6-7(2)9(4)12-11(8(6)3)10(5)14-16-13(12)15/h1-5H3 |
| InChIKey | FXBJXTZSWWTKFS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |