About (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide
(2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide (PubChem CID 22946144) has the molecular formula C13H18Cl2N2O3
and a molecular weight of 321.20 g/mol. Its IUPAC name is (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide.
Molecular Properties
| Compound Name | (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide |
| PubChem CID | 22946144 |
| Molecular Formula | C13H18Cl2N2O3 |
| Molecular Weight | 321.20 g/mol |
| Exact Mass | 320.07 |
| IUPAC Name | (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide |
| SMILES | N[C@@H](Cc1ccc(Cl)c(Cl)c1)C(=O)NCCOCCO |
| InChI | InChI=1S/C13H18Cl2N2O3/c14-10-2-1-9(7-11(10)15)8-12(16)13(19)17-3-5-20-6-4-18/h1-2,7,12,18H,3-6,8,16H2,(H,17,19)/t12-/m0/s1 |
| InChIKey | FCYXQSWHVFZDBY-LBPRGKRZSA-N |
| XLogP | 0.99 |
| TPSA | 84.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 321.20 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide?
The IUPAC name of (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide (CID 22946144) is (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide.
What is the SMILES notation for (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide?
The canonical SMILES for (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide is N[C@@H](Cc1ccc(Cl)c(Cl)c1)C(=O)NCCOCCO.
What is the InChIKey of (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide?
The InChIKey is FCYXQSWHVFZDBY-LBPRGKRZSA-N. The full InChI is InChI=1S/C13H18Cl2N2O3/c14-10-2-1-9(7-11(10)15)8-12(16)13(19)17-3-5-20-6-4-18/h1-2,7,12,18H,3-6,8,16H2,(H,17,19)/t12-/m0/s1.
What are the key properties of (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide?
(2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide has a molecular weight of 321.20 g/mol, XLogP of 0.99, 8 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-amino-3-(3,4-dichlorophenyl)-N-[2-(2-hydroxyethoxy)ethyl]propanamide is sourced from PubChem (CID 22946144), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).