C19H28Cl2N2O5 — CID 22946149
N-[(2S)-3-(3,4-dichlorophenyl)-1-[(2-ethoxy-2-hydroxyethyl)amino]-1-oxopropan-2-yl]-N-hydroxy-4-methylpentanamide (PubChem CID 22946149) has the molecular formula C19H28Cl2N2O5 and a molecular weight of 435.35 g/mol. Its IUPAC name is N-[(2S)-3-(3,4-dichlorophenyl)-1-[(2-ethoxy-2-hydroxyethyl)amino]-1-oxopropan-2-yl]-N-hydroxy-4-methylpentanamide.
| Compound Name | N-[(2S)-3-(3,4-dichlorophenyl)-1-[(2-ethoxy-2-hydroxyethyl)amino]-1-oxopropan-2-yl]-N-hydroxy-4-methylpentanamide |
|---|---|
| PubChem CID | 22946149 |
| Molecular Formula | C19H28Cl2N2O5 |
| Molecular Weight | 435.35 g/mol |
| Exact Mass | 434.14 |
| IUPAC Name | N-[(2S)-3-(3,4-dichlorophenyl)-1-[(2-ethoxy-2-hydroxyethyl)amino]-1-oxopropan-2-yl]-N-hydroxy-4-methylpentanamide |
| SMILES | CCOC(O)CNC(=O)[C@H](Cc1ccc(Cl)c(Cl)c1)N(O)C(=O)CCC(C)C |
| InChI | InChI=1S/C19H28Cl2N2O5/c1-4-28-18(25)11-22-19(26)16(23(27)17(24)8-5-12(2)3)10-13-6-7-14(20)15(21)9-13/h6-7,9,12,16,18,25,27H,4-5,8,10-11H2,1-3H3,(H,22,26)/t16-,18?/m0/s1 |
| InChIKey | CXEQJYAEKUCWHC-ATNAJCNCSA-N |
| XLogP | 3.03 |
| TPSA | 99.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|