C18H25Cl2N3O5 — CID 22946158
(2S)-N-[3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-2-(2-methylpropyl)butanediamide (PubChem CID 22946158) has the molecular formula C18H25Cl2N3O5 and a molecular weight of 434.32 g/mol. Its IUPAC name is (2S)-N-[3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-2-(2-methylpropyl)butanediamide.
| Compound Name | (2S)-N-[3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-2-(2-methylpropyl)butanediamide |
|---|---|
| PubChem CID | 22946158 |
| Molecular Formula | C18H25Cl2N3O5 |
| Molecular Weight | 434.32 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | (2S)-N-[3-(3,4-dichlorophenyl)-1-(methylamino)-1-oxopropan-2-yl]-N',2-dihydroxy-2-(2-methylpropyl)butanediamide |
| SMILES | CNC(=O)C(Cc1ccc(Cl)c(Cl)c1)NC(=O)[C@@](O)(CC(=O)NO)CC(C)C |
| InChI | InChI=1S/C18H25Cl2N3O5/c1-10(2)8-18(27,9-15(24)23-28)17(26)22-14(16(25)21-3)7-11-4-5-12(19)13(20)6-11/h4-6,10,14,27-28H,7-9H2,1-3H3,(H,21,25)(H,22,26)(H,23,24)/t14?,18-/m0/s1 |
| InChIKey | PSYKLVPKHBTJEQ-IBYPIGCZSA-N |
| XLogP | 1.44 |
| TPSA | 127.76 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|