About (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane
(3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane (PubChem CID 22946674) has the molecular formula C26H34Si2
and a molecular weight of 402.73 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane.
Molecular Properties
| Compound Name | (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane |
| PubChem CID | 22946674 |
| Molecular Formula | C26H34Si2 |
| Molecular Weight | 402.73 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane |
| SMILES | Cc1ccc([Si](C)(C)c2ccc([Si](C)(C)c3ccc(C)c(C)c3)cc2)cc1C |
| InChI | InChI=1S/C26H34Si2/c1-19-9-11-25(17-21(19)3)27(5,6)23-13-15-24(16-14-23)28(7,8)26-12-10-20(2)22(4)18-26/h9-18H,1-8H3 |
| InChIKey | QCFNYLNIWDYASZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.73 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane?
The IUPAC name of (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane (CID 22946674) is (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane.
What is the SMILES notation for (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane?
The canonical SMILES for (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane is Cc1ccc([Si](C)(C)c2ccc([Si](C)(C)c3ccc(C)c(C)c3)cc2)cc1C.
What is the InChIKey of (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane?
The InChIKey is QCFNYLNIWDYASZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H34Si2/c1-19-9-11-25(17-21(19)3)27(5,6)23-13-15-24(16-14-23)28(7,8)26-12-10-20(2)22(4)18-26/h9-18H,1-8H3.
What are the key properties of (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane?
(3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane has a molecular weight of 402.73 g/mol, XLogP of 4.57, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-dimethylphenyl)-[4-[(3,4-dimethylphenyl)-dimethylsilyl]phenyl]-dimethylsilane is sourced from PubChem (CID 22946674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).