About 7-methylidene-1,5-dithiocan-3-ol
7-methylidene-1,5-dithiocan-3-ol (PubChem CID 22946761) has the molecular formula C7H12OS2
and a molecular weight of 176.31 g/mol. Its IUPAC name is 7-methylidene-1,5-dithiocan-3-ol.
Molecular Properties
| Compound Name | 7-methylidene-1,5-dithiocan-3-ol |
| PubChem CID | 22946761 |
| Molecular Formula | C7H12OS2 |
| Molecular Weight | 176.31 g/mol |
| Exact Mass | 176.03 |
| IUPAC Name | 7-methylidene-1,5-dithiocan-3-ol |
| SMILES | C=C1CSCC(O)CSC1 |
| InChI | InChI=1S/C7H12OS2/c1-6-2-9-4-7(8)5-10-3-6/h7-8H,1-5H2 |
| InChIKey | JXCHFZJOTDIFBL-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.31 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 7-methylidene-1,5-dithiocan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylidene-1,5-dithiocan-3-ol?
The IUPAC name of 7-methylidene-1,5-dithiocan-3-ol (CID 22946761) is 7-methylidene-1,5-dithiocan-3-ol.
What is the SMILES notation for 7-methylidene-1,5-dithiocan-3-ol?
The canonical SMILES for 7-methylidene-1,5-dithiocan-3-ol is C=C1CSCC(O)CSC1.
What is the InChIKey of 7-methylidene-1,5-dithiocan-3-ol?
The InChIKey is JXCHFZJOTDIFBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12OS2/c1-6-2-9-4-7(8)5-10-3-6/h7-8H,1-5H2.
What are the key properties of 7-methylidene-1,5-dithiocan-3-ol?
7-methylidene-1,5-dithiocan-3-ol has a molecular weight of 176.31 g/mol, XLogP of 1.38, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylidene-1,5-dithiocan-3-ol is sourced from PubChem (CID 22946761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).