About (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene
(4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene (PubChem CID 22946830) has the molecular formula C20H22N2
and a molecular weight of 290.41 g/mol. Its IUPAC name is (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene.
Molecular Properties
| Compound Name | (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene |
| PubChem CID | 22946830 |
| Molecular Formula | C20H22N2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.18 |
| IUPAC Name | (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene |
| SMILES | CC1=CCC(C)(C)c2ccc(/N=N/c3ccc(C)cc3)cc21 |
| InChI | InChI=1S/C20H22N2/c1-14-5-7-16(8-6-14)21-22-17-9-10-19-18(13-17)15(2)11-12-20(19,3)4/h5-11,13H,12H2,1-4H3/b22-21+ |
| InChIKey | KKFOPHOSSYSCGJ-QURGRASLSA-N |
| XLogP | 6.50 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene?
The IUPAC name of (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene (CID 22946830) is (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene.
What is the SMILES notation for (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene?
The canonical SMILES for (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene is CC1=CCC(C)(C)c2ccc(/N=N/c3ccc(C)cc3)cc21.
What is the InChIKey of (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene?
The InChIKey is KKFOPHOSSYSCGJ-QURGRASLSA-N. The full InChI is InChI=1S/C20H22N2/c1-14-5-7-16(8-6-14)21-22-17-9-10-19-18(13-17)15(2)11-12-20(19,3)4/h5-11,13H,12H2,1-4H3/b22-21+.
What are the key properties of (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene?
(4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene has a molecular weight of 290.41 g/mol, XLogP of 6.50, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methylphenyl)-(5,5,8-trimethyl-6H-naphthalen-2-yl)diazene is sourced from PubChem (CID 22946830), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).