About 2-nitroethanesulfonyl chloride
2-nitroethanesulfonyl chloride (PubChem CID 22946839) has the molecular formula C2H4ClNO4S
and a molecular weight of 173.58 g/mol. Its IUPAC name is 2-nitroethanesulfonyl chloride.
Molecular Properties
| Compound Name | 2-nitroethanesulfonyl chloride |
| PubChem CID | 22946839 |
| Molecular Formula | C2H4ClNO4S |
| Molecular Weight | 173.58 g/mol |
| Exact Mass | 172.95 |
| IUPAC Name | 2-nitroethanesulfonyl chloride |
| SMILES | O=[N+]([O-])CCS(=O)(=O)Cl |
| InChI | InChI=1S/C2H4ClNO4S/c3-9(7,8)2-1-4(5)6/h1-2H2 |
| InChIKey | FEKOETYNDSDXCS-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 77.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.58 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-nitroethanesulfonyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-nitroethanesulfonyl chloride?
The IUPAC name of 2-nitroethanesulfonyl chloride (CID 22946839) is 2-nitroethanesulfonyl chloride.
What is the SMILES notation for 2-nitroethanesulfonyl chloride?
The canonical SMILES for 2-nitroethanesulfonyl chloride is O=[N+]([O-])CCS(=O)(=O)Cl.
What is the InChIKey of 2-nitroethanesulfonyl chloride?
The InChIKey is FEKOETYNDSDXCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClNO4S/c3-9(7,8)2-1-4(5)6/h1-2H2.
What are the key properties of 2-nitroethanesulfonyl chloride?
2-nitroethanesulfonyl chloride has a molecular weight of 173.58 g/mol, XLogP of -0.17, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-nitroethanesulfonyl chloride is sourced from PubChem (CID 22946839), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).