About N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid
N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid (PubChem CID 22946990) has the molecular formula C12H29BNO7P
and a molecular weight of 341.15 g/mol. Its IUPAC name is N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid.
Molecular Properties
| Compound Name | N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid |
| PubChem CID | 22946990 |
| Molecular Formula | C12H29BNO7P |
| Molecular Weight | 341.15 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid |
| SMILES | CCOCC(COP(=O)(OC)OCCN(C)B(C)O)OCC |
| InChI | InChI=1S/C12H29BNO7P/c1-6-18-10-12(19-7-2)11-21-22(16,17-5)20-9-8-14(4)13(3)15/h12,15H,6-11H2,1-5H3 |
| InChIKey | OEVKFUJIRYTUHQ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 341.15 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid?
The IUPAC name of N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid (CID 22946990) is N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid.
What is the SMILES notation for N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid?
The canonical SMILES for N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid is CCOCC(COP(=O)(OC)OCCN(C)B(C)O)OCC.
What is the InChIKey of N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid?
The InChIKey is OEVKFUJIRYTUHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H29BNO7P/c1-6-18-10-12(19-7-2)11-21-22(16,17-5)20-9-8-14(4)13(3)15/h12,15H,6-11H2,1-5H3.
What are the key properties of N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid?
N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid has a molecular weight of 341.15 g/mol, XLogP of 1.26, 14 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-[2,3-diethoxypropoxy(methoxy)phosphoryl]oxyethyl]-N-dimethylboronamidic acid is sourced from PubChem (CID 22946990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).