About 3,4-dimethoxy-2,5-dimethylthiolane
3,4-dimethoxy-2,5-dimethylthiolane (PubChem CID 22947094) has the molecular formula C8H16O2S
and a molecular weight of 176.28 g/mol. Its IUPAC name is 3,4-dimethoxy-2,5-dimethylthiolane.
Molecular Properties
| Compound Name | 3,4-dimethoxy-2,5-dimethylthiolane |
| PubChem CID | 22947094 |
| Molecular Formula | C8H16O2S |
| Molecular Weight | 176.28 g/mol |
| Exact Mass | 176.09 |
| IUPAC Name | 3,4-dimethoxy-2,5-dimethylthiolane |
| SMILES | COC1C(C)SC(C)C1OC |
| InChI | InChI=1S/C8H16O2S/c1-5-7(9-3)8(10-4)6(2)11-5/h5-8H,1-4H3 |
| InChIKey | HDNZXBHLHSZQSJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,4-dimethoxy-2,5-dimethylthiolane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,4-dimethoxy-2,5-dimethylthiolane?
The IUPAC name of 3,4-dimethoxy-2,5-dimethylthiolane (CID 22947094) is 3,4-dimethoxy-2,5-dimethylthiolane.
What is the SMILES notation for 3,4-dimethoxy-2,5-dimethylthiolane?
The canonical SMILES for 3,4-dimethoxy-2,5-dimethylthiolane is COC1C(C)SC(C)C1OC.
What is the InChIKey of 3,4-dimethoxy-2,5-dimethylthiolane?
The InChIKey is HDNZXBHLHSZQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2S/c1-5-7(9-3)8(10-4)6(2)11-5/h5-8H,1-4H3.
What are the key properties of 3,4-dimethoxy-2,5-dimethylthiolane?
3,4-dimethoxy-2,5-dimethylthiolane has a molecular weight of 176.28 g/mol, XLogP of 1.54, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,4-dimethoxy-2,5-dimethylthiolane is sourced from PubChem (CID 22947094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).