About 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol
4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol (PubChem CID 22947162) has the molecular formula C20H26O2
and a molecular weight of 298.43 g/mol. Its IUPAC name is 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol.
Molecular Properties
| Compound Name | 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol |
| PubChem CID | 22947162 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol |
| SMILES | CCCC(c1cc(C)c(O)cc1C)c1cc(C)c(O)cc1C |
| InChI | InChI=1S/C20H26O2/c1-6-7-16(17-8-14(4)19(21)10-12(17)2)18-9-15(5)20(22)11-13(18)3/h8-11,16,21-22H,6-7H2,1-5H3 |
| InChIKey | MPUZVECZRMNNKA-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol?
The IUPAC name of 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol (CID 22947162) is 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol.
What is the SMILES notation for 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol?
The canonical SMILES for 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol is CCCC(c1cc(C)c(O)cc1C)c1cc(C)c(O)cc1C.
What is the InChIKey of 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol?
The InChIKey is MPUZVECZRMNNKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26O2/c1-6-7-16(17-8-14(4)19(21)10-12(17)2)18-9-15(5)20(22)11-13(18)3/h8-11,16,21-22H,6-7H2,1-5H3.
What are the key properties of 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol?
4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol has a molecular weight of 298.43 g/mol, XLogP of 5.26, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[1-(4-hydroxy-2,5-dimethylphenyl)butyl]-2,5-dimethylphenol is sourced from PubChem (CID 22947162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).