About (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite
(1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite (PubChem CID 22947349) has the molecular formula C13H6F3NO5S
and a molecular weight of 345.25 g/mol. Its IUPAC name is (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite.
Molecular Properties
| Compound Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite |
| PubChem CID | 22947349 |
| Molecular Formula | C13H6F3NO5S |
| Molecular Weight | 345.25 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite |
| SMILES | O=C1c2cccc3cccc(c23)C(=O)N1OS(=O)OC(F)(F)F |
| InChI | InChI=1S/C13H6F3NO5S/c14-13(15,16)21-23(20)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19/h1-6H |
| InChIKey | JIUWUZRQRLCFFY-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.25 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite?
The IUPAC name of (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite (CID 22947349) is (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite.
What is the SMILES notation for (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite?
The canonical SMILES for (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite is O=C1c2cccc3cccc(c23)C(=O)N1OS(=O)OC(F)(F)F.
What is the InChIKey of (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite?
The InChIKey is JIUWUZRQRLCFFY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H6F3NO5S/c14-13(15,16)21-23(20)22-17-11(18)8-5-1-3-7-4-2-6-9(10(7)8)12(17)19/h1-6H.
What are the key properties of (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite?
(1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite has a molecular weight of 345.25 g/mol, XLogP of 2.48, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1,3-dioxobenzo[de]isoquinolin-2-yl) trifluoromethyl sulfite is sourced from PubChem (CID 22947349), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).