About 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one
1,3-diethyl-2,5-dimethylideneimidazolidin-4-one (PubChem CID 22947371) has the molecular formula C9H14N2O
and a molecular weight of 166.22 g/mol. Its IUPAC name is 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one.
Molecular Properties
| Compound Name | 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one |
| PubChem CID | 22947371 |
| Molecular Formula | C9H14N2O |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.11 |
| IUPAC Name | 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one |
| SMILES | C=c1c(=O)n(CC)c(=C)n1CC |
| InChI | InChI=1S/C9H14N2O/c1-5-10-7(3)9(12)11(6-2)8(10)4/h3-6H2,1-2H3 |
| InChIKey | YZDAFDUKMCTKFN-UHFFFAOYSA-N |
| XLogP | -0.49 |
| TPSA | 26.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one?
The IUPAC name of 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one (CID 22947371) is 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one.
What is the SMILES notation for 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one?
The canonical SMILES for 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one is C=c1c(=O)n(CC)c(=C)n1CC.
What is the InChIKey of 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one?
The InChIKey is YZDAFDUKMCTKFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O/c1-5-10-7(3)9(12)11(6-2)8(10)4/h3-6H2,1-2H3.
What are the key properties of 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one?
1,3-diethyl-2,5-dimethylideneimidazolidin-4-one has a molecular weight of 166.22 g/mol, XLogP of -0.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-2,5-dimethylideneimidazolidin-4-one is sourced from PubChem (CID 22947371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).