C13H26N5S2- — CID 22947561
4-[4-(diethylcarbamothioylamino)butyl]-2,3-dimethyl-3H-1,2,4-triazole-5-thiolate (PubChem CID 22947561) has the molecular formula C13H26N5S2- and a molecular weight of 316.52 g/mol. Its IUPAC name is 4-[4-(diethylcarbamothioylamino)butyl]-2,3-dimethyl-3H-1,2,4-triazole-5-thiolate.
| Compound Name | 4-[4-(diethylcarbamothioylamino)butyl]-2,3-dimethyl-3H-1,2,4-triazole-5-thiolate |
|---|---|
| PubChem CID | 22947561 |
| Molecular Formula | C13H26N5S2- |
| Molecular Weight | 316.52 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 4-[4-(diethylcarbamothioylamino)butyl]-2,3-dimethyl-3H-1,2,4-triazole-5-thiolate |
| SMILES | CCN(CC)C(=S)NCCCCN1C([S-])=NN(C)C1C |
| InChI | InChI=1S/C13H27N5S2/c1-5-17(6-2)12(19)14-9-7-8-10-18-11(3)16(4)15-13(18)20/h11H,5-10H2,1-4H3,(H,14,19)(H,15,20)/p-1 |
| InChIKey | RMYOJEGJHVHFEJ-UHFFFAOYSA-M |
| XLogP | 1.39 |
| TPSA | 34.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.52 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|