C13H27N5S2 — CID 22947562
3-[4-(1,5-dimethyl-3-sulfanylidene-1,2,4-triazolidin-4-yl)butyl]-1,1-diethylthiourea (PubChem CID 22947562) has the molecular formula C13H27N5S2 and a molecular weight of 317.53 g/mol. Its IUPAC name is 3-[4-(1,5-dimethyl-3-sulfanylidene-1,2,4-triazolidin-4-yl)butyl]-1,1-diethylthiourea.
| Compound Name | 3-[4-(1,5-dimethyl-3-sulfanylidene-1,2,4-triazolidin-4-yl)butyl]-1,1-diethylthiourea |
|---|---|
| PubChem CID | 22947562 |
| Molecular Formula | C13H27N5S2 |
| Molecular Weight | 317.53 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 3-[4-(1,5-dimethyl-3-sulfanylidene-1,2,4-triazolidin-4-yl)butyl]-1,1-diethylthiourea |
| SMILES | CCN(CC)C(=S)NCCCCN1C(=S)NN(C)C1C |
| InChI | InChI=1S/C13H27N5S2/c1-5-17(6-2)12(19)14-9-7-8-10-18-11(3)16(4)15-13(18)20/h11H,5-10H2,1-4H3,(H,14,19)(H,15,20) |
| InChIKey | RMYOJEGJHVHFEJ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 33.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|