C5H10N2+2 — CID 22947747
1,3-dimethyl-1H-imidazole-1,3-diium (PubChem CID 22947747) has the molecular formula C5H10N2+2 and a molecular weight of 98.15 g/mol. Its IUPAC name is 1,3-dimethyl-1H-imidazole-1,3-diium.
| Compound Name | 1,3-dimethyl-1H-imidazole-1,3-diium |
|---|---|
| PubChem CID | 22947747 |
| Molecular Formula | C5H10N2+2 |
| Molecular Weight | 98.15 g/mol |
| Exact Mass | 98.08 |
| IUPAC Name | 1,3-dimethyl-1H-imidazole-1,3-diium |
| SMILES | C[N+]1=C[NH+](C)C=C1 |
| InChI | InChI=1S/C5H9N2/c1-6-3-4-7(2)5-6/h3-5H,1-2H3/q+1/p+1 |
| InChIKey | HVVRUQBMAZRKPJ-UHFFFAOYSA-O |
| XLogP | -1.34 |
| TPSA | 7.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 98.15 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|