About 3-ethyl-5-methyl-1,2,4-thiadiazole
3-ethyl-5-methyl-1,2,4-thiadiazole (PubChem CID 22947825) has the molecular formula C5H8N2S
and a molecular weight of 128.20 g/mol. Its IUPAC name is 3-ethyl-5-methyl-1,2,4-thiadiazole.
Molecular Properties
| Compound Name | 3-ethyl-5-methyl-1,2,4-thiadiazole |
| PubChem CID | 22947825 |
| Molecular Formula | C5H8N2S |
| Molecular Weight | 128.20 g/mol |
| Exact Mass | 128.04 |
| IUPAC Name | 3-ethyl-5-methyl-1,2,4-thiadiazole |
| SMILES | CCc1nsc(C)n1 |
| InChI | InChI=1S/C5H8N2S/c1-3-5-6-4(2)8-7-5/h3H2,1-2H3 |
| InChIKey | JFQIQVLTZXGDKS-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.20 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-ethyl-5-methyl-1,2,4-thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-5-methyl-1,2,4-thiadiazole?
The IUPAC name of 3-ethyl-5-methyl-1,2,4-thiadiazole (CID 22947825) is 3-ethyl-5-methyl-1,2,4-thiadiazole.
What is the SMILES notation for 3-ethyl-5-methyl-1,2,4-thiadiazole?
The canonical SMILES for 3-ethyl-5-methyl-1,2,4-thiadiazole is CCc1nsc(C)n1.
What is the InChIKey of 3-ethyl-5-methyl-1,2,4-thiadiazole?
The InChIKey is JFQIQVLTZXGDKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2S/c1-3-5-6-4(2)8-7-5/h3H2,1-2H3.
What are the key properties of 3-ethyl-5-methyl-1,2,4-thiadiazole?
3-ethyl-5-methyl-1,2,4-thiadiazole has a molecular weight of 128.20 g/mol, XLogP of 1.41, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-5-methyl-1,2,4-thiadiazole is sourced from PubChem (CID 22947825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).