C34H53N3O7 — CID 22947993
4,10,16-trimethyl-3,9-bis(2-methylpropyl)-6-[(4-morpholin-4-ylphenyl)methyl]-1,7-dioxa-4,10-diazacyclohexadecane-2,5,8,15-tetrone (PubChem CID 22947993) has the molecular formula C34H53N3O7 and a molecular weight of 615.81 g/mol. Its IUPAC name is 4,10,16-trimethyl-3,9-bis(2-methylpropyl)-6-[(4-morpholin-4-ylphenyl)methyl]-1,7-dioxa-4,10-diazacyclohexadecane-2,5,8,15-tetrone.
| Compound Name | 4,10,16-trimethyl-3,9-bis(2-methylpropyl)-6-[(4-morpholin-4-ylphenyl)methyl]-1,7-dioxa-4,10-diazacyclohexadecane-2,5,8,15-tetrone |
|---|---|
| PubChem CID | 22947993 |
| Molecular Formula | C34H53N3O7 |
| Molecular Weight | 615.81 g/mol |
| Exact Mass | 615.39 |
| IUPAC Name | 4,10,16-trimethyl-3,9-bis(2-methylpropyl)-6-[(4-morpholin-4-ylphenyl)methyl]-1,7-dioxa-4,10-diazacyclohexadecane-2,5,8,15-tetrone |
| SMILES | CC(C)CC1C(=O)OC(Cc2ccc(N3CCOCC3)cc2)C(=O)N(C)C(CC(C)C)C(=O)OC(C)C(=O)CCCCN1C |
| InChI | InChI=1S/C34H53N3O7/c1-23(2)20-28-33(40)44-31(22-26-11-13-27(14-12-26)37-16-18-42-19-17-37)32(39)36(7)29(21-24(3)4)34(41)43-25(5)30(38)10-8-9-15-35(28)6/h11-14,23-25,28-29,31H,8-10,15-22H2,1-7H3 |
| InChIKey | QATYGRSCRLIPPT-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 105.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|