C37H72N8 — CID 22948077
6-methyl-2-N-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine (PubChem CID 22948077) has the molecular formula C37H72N8 and a molecular weight of 629.04 g/mol. Its IUPAC name is 6-methyl-2-N-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-methyl-2-N-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 22948077 |
| Molecular Formula | C37H72N8 |
| Molecular Weight | 629.04 g/mol |
| Exact Mass | 628.59 |
| IUPAC Name | 6-methyl-2-N-[6-[methyl-(2,2,6,6-tetramethylpiperidin-4-yl)amino]hexyl]-2-N-(2,2,6,6-tetramethylpiperidin-4-yl)-4-N-(2,4,4-trimethylpentan-2-yl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1nc(NC(C)(C)CC(C)(C)C)nc(N(CCCCCCN(C)C2CC(C)(C)NC(C)(C)C2)C2CC(C)(C)NC(C)(C)C2)n1 |
| InChI | InChI=1S/C37H72N8/c1-27-38-30(41-37(13,14)26-32(2,3)4)40-31(39-27)45(29-24-35(9,10)43-36(11,12)25-29)21-19-17-16-18-20-44(15)28-22-33(5,6)42-34(7,8)23-28/h28-29,42-43H,16-26H2,1-15H3,(H,38,39,40,41) |
| InChIKey | TZPIRNSFKLBHSS-UHFFFAOYSA-N |
| XLogP | 7.72 |
| TPSA | 81.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.04 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|