About 3-ethyl-1,5-dimethylimidazolidine-2,4-dione
3-ethyl-1,5-dimethylimidazolidine-2,4-dione (PubChem CID 22948529) has the molecular formula C7H12N2O2
and a molecular weight of 156.18 g/mol. Its IUPAC name is 3-ethyl-1,5-dimethylimidazolidine-2,4-dione.
Molecular Properties
| Compound Name | 3-ethyl-1,5-dimethylimidazolidine-2,4-dione |
| PubChem CID | 22948529 |
| Molecular Formula | C7H12N2O2 |
| Molecular Weight | 156.18 g/mol |
| Exact Mass | 156.09 |
| IUPAC Name | 3-ethyl-1,5-dimethylimidazolidine-2,4-dione |
| SMILES | CCN1C(=O)C(C)N(C)C1=O |
| InChI | InChI=1S/C7H12N2O2/c1-4-9-6(10)5(2)8(3)7(9)11/h5H,4H2,1-3H3 |
| InChIKey | JDEKWJQJLQHLBF-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.18 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|
Analyze 3-ethyl-1,5-dimethylimidazolidine-2,4-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-ethyl-1,5-dimethylimidazolidine-2,4-dione?
The IUPAC name of 3-ethyl-1,5-dimethylimidazolidine-2,4-dione (CID 22948529) is 3-ethyl-1,5-dimethylimidazolidine-2,4-dione.
What is the SMILES notation for 3-ethyl-1,5-dimethylimidazolidine-2,4-dione?
The canonical SMILES for 3-ethyl-1,5-dimethylimidazolidine-2,4-dione is CCN1C(=O)C(C)N(C)C1=O.
What is the InChIKey of 3-ethyl-1,5-dimethylimidazolidine-2,4-dione?
The InChIKey is JDEKWJQJLQHLBF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O2/c1-4-9-6(10)5(2)8(3)7(9)11/h5H,4H2,1-3H3.
What are the key properties of 3-ethyl-1,5-dimethylimidazolidine-2,4-dione?
3-ethyl-1,5-dimethylimidazolidine-2,4-dione has a molecular weight of 156.18 g/mol, XLogP of 0.29, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-ethyl-1,5-dimethylimidazolidine-2,4-dione is sourced from PubChem (CID 22948529), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).