About 4-ethyl-1-methylpyrazole
4-ethyl-1-methylpyrazole (PubChem CID 22948535) has the molecular formula C6H10N2
and a molecular weight of 110.16 g/mol. Its IUPAC name is 4-ethyl-1-methylpyrazole.
Molecular Properties
| Compound Name | 4-ethyl-1-methylpyrazole |
| PubChem CID | 22948535 |
| Molecular Formula | C6H10N2 |
| Molecular Weight | 110.16 g/mol |
| Exact Mass | 110.08 |
| IUPAC Name | 4-ethyl-1-methylpyrazole |
| SMILES | CCc1cnn(C)c1 |
| InChI | InChI=1S/C6H10N2/c1-3-6-4-7-8(2)5-6/h4-5H,3H2,1-2H3 |
| InChIKey | UJGITZCPMNZJMH-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.16 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-1-methylpyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-1-methylpyrazole?
The IUPAC name of 4-ethyl-1-methylpyrazole (CID 22948535) is 4-ethyl-1-methylpyrazole.
What is the SMILES notation for 4-ethyl-1-methylpyrazole?
The canonical SMILES for 4-ethyl-1-methylpyrazole is CCc1cnn(C)c1.
What is the InChIKey of 4-ethyl-1-methylpyrazole?
The InChIKey is UJGITZCPMNZJMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10N2/c1-3-6-4-7-8(2)5-6/h4-5H,3H2,1-2H3.
What are the key properties of 4-ethyl-1-methylpyrazole?
4-ethyl-1-methylpyrazole has a molecular weight of 110.16 g/mol, XLogP of 0.98, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-1-methylpyrazole is sourced from PubChem (CID 22948535), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).