C21H28N4 — CID 22948900
3-[[2,5-dimethyl-3-(2,3,4,5,6-pentamethylphenyl)pyrrol-1-yl]methyl]-1-methyl-1,2,4-triazole (PubChem CID 22948900) has the molecular formula C21H28N4 and a molecular weight of 336.48 g/mol. Its IUPAC name is 3-[[2,5-dimethyl-3-(2,3,4,5,6-pentamethylphenyl)pyrrol-1-yl]methyl]-1-methyl-1,2,4-triazole.
| Compound Name | 3-[[2,5-dimethyl-3-(2,3,4,5,6-pentamethylphenyl)pyrrol-1-yl]methyl]-1-methyl-1,2,4-triazole |
|---|---|
| PubChem CID | 22948900 |
| Molecular Formula | C21H28N4 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | 3-[[2,5-dimethyl-3-(2,3,4,5,6-pentamethylphenyl)pyrrol-1-yl]methyl]-1-methyl-1,2,4-triazole |
| SMILES | Cc1c(C)c(C)c(-c2cc(C)n(Cc3ncn(C)n3)c2C)c(C)c1C |
| InChI | InChI=1S/C21H28N4/c1-12-9-19(18(7)25(12)10-20-22-11-24(8)23-20)21-16(5)14(3)13(2)15(4)17(21)6/h9,11H,10H2,1-8H3 |
| InChIKey | BMGKTIXIZYHADW-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |