C18H21F3N4 — CID 22948905
3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)indole (PubChem CID 22948905) has the molecular formula C18H21F3N4 and a molecular weight of 350.39 g/mol. Its IUPAC name is 3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)indole.
| Compound Name | 3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)indole |
|---|---|
| PubChem CID | 22948905 |
| Molecular Formula | C18H21F3N4 |
| Molecular Weight | 350.39 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 3,4,5,6,7-pentamethyl-1-[(1-methyl-1,2,4-triazol-3-yl)methyl]-2-(trifluoromethyl)indole |
| SMILES | Cc1c(C)c(C)c2c(c1C)c(C)c(C(F)(F)F)n2Cc1ncn(C)n1 |
| InChI | InChI=1S/C18H21F3N4/c1-9-10(2)12(4)16-15(11(9)3)13(5)17(18(19,20)21)25(16)7-14-22-8-24(6)23-14/h8H,7H2,1-6H3 |
| InChIKey | AQTWYHXYKDFFTK-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 35.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.39 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |