C11H14N2O — CID 22948964
2,4,7-trimethyl-7,8-dihydro-6H-quinazolin-5-one (PubChem CID 22948964) has the molecular formula C11H14N2O and a molecular weight of 190.25 g/mol. Its IUPAC name is 2,4,7-trimethyl-7,8-dihydro-6H-quinazolin-5-one.
| Compound Name | 2,4,7-trimethyl-7,8-dihydro-6H-quinazolin-5-one |
|---|---|
| PubChem CID | 22948964 |
| Molecular Formula | C11H14N2O |
| Molecular Weight | 190.25 g/mol |
| Exact Mass | 190.11 |
| IUPAC Name | 2,4,7-trimethyl-7,8-dihydro-6H-quinazolin-5-one |
| SMILES | Cc1nc(C)c2c(n1)CC(C)CC2=O |
| InChI | InChI=1S/C11H14N2O/c1-6-4-9-11(10(14)5-6)7(2)12-8(3)13-9/h6H,4-5H2,1-3H3 |
| InChIKey | LWDHUYITIPYHGV-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.25 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |