About 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine
5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine (PubChem CID 22949007) has the molecular formula C8H10N4
and a molecular weight of 162.20 g/mol. Its IUPAC name is 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine.
Molecular Properties
| Compound Name | 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine |
| PubChem CID | 22949007 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine |
| SMILES | Cc1cn(C)c2nc(N)ncc12 |
| InChI | InChI=1S/C8H10N4/c1-5-4-12(2)7-6(5)3-10-8(9)11-7/h3-4H,1-2H3,(H2,9,10,11) |
| InChIKey | UDDVLAQCIXPPFT-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine?
The IUPAC name of 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine (CID 22949007) is 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine.
What is the SMILES notation for 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine?
The canonical SMILES for 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine is Cc1cn(C)c2nc(N)ncc12.
What is the InChIKey of 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine?
The InChIKey is UDDVLAQCIXPPFT-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4/c1-5-4-12(2)7-6(5)3-10-8(9)11-7/h3-4H,1-2H3,(H2,9,10,11).
What are the key properties of 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine?
5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine has a molecular weight of 162.20 g/mol, XLogP of 0.86, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dimethylpyrrolo[2,3-d]pyrimidin-2-amine is sourced from PubChem (CID 22949007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).