About 9-methylpurine-2,6-diamine
9-methylpurine-2,6-diamine (PubChem CID 22949012) has the molecular formula C6H8N6
and a molecular weight of 164.17 g/mol. Its IUPAC name is 9-methylpurine-2,6-diamine.
Molecular Properties
| Compound Name | 9-methylpurine-2,6-diamine |
| PubChem CID | 22949012 |
| Molecular Formula | C6H8N6 |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | 9-methylpurine-2,6-diamine |
| SMILES | Cn1cnc2c(N)nc(N)nc21 |
| InChI | InChI=1S/C6H8N6/c1-12-2-9-3-4(7)10-6(8)11-5(3)12/h2H,1H3,(H4,7,8,10,11) |
| InChIKey | NMJOZGVQPPGGFV-UHFFFAOYSA-N |
| XLogP | -0.47 |
| TPSA | 95.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-methylpurine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methylpurine-2,6-diamine?
The IUPAC name of 9-methylpurine-2,6-diamine (CID 22949012) is 9-methylpurine-2,6-diamine.
What is the SMILES notation for 9-methylpurine-2,6-diamine?
The canonical SMILES for 9-methylpurine-2,6-diamine is Cn1cnc2c(N)nc(N)nc21.
What is the InChIKey of 9-methylpurine-2,6-diamine?
The InChIKey is NMJOZGVQPPGGFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N6/c1-12-2-9-3-4(7)10-6(8)11-5(3)12/h2H,1H3,(H4,7,8,10,11).
What are the key properties of 9-methylpurine-2,6-diamine?
9-methylpurine-2,6-diamine has a molecular weight of 164.17 g/mol, XLogP of -0.47, 0 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methylpurine-2,6-diamine is sourced from PubChem (CID 22949012), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).