About 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one
4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one (PubChem CID 22949121) has the molecular formula C25H22F3NO3
and a molecular weight of 441.45 g/mol. Its IUPAC name is 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one.
Molecular Properties
| Compound Name | 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one |
| PubChem CID | 22949121 |
| Molecular Formula | C25H22F3NO3 |
| Molecular Weight | 441.45 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one |
| SMILES | CN1C(Cc2ccc(OC(F)(F)F)cc2)C(=O)OC(c2ccccc2)C1c1ccccc1 |
| InChI | InChI=1S/C25H22F3NO3/c1-29-21(16-17-12-14-20(15-13-17)32-25(26,27)28)24(30)31-23(19-10-6-3-7-11-19)22(29)18-8-4-2-5-9-18/h2-15,21-23H,16H2,1H3 |
| InChIKey | SYWFVULUMHLCBM-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 441.45 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one?
The IUPAC name of 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one (CID 22949121) is 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one.
What is the SMILES notation for 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one?
The canonical SMILES for 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one is CN1C(Cc2ccc(OC(F)(F)F)cc2)C(=O)OC(c2ccccc2)C1c1ccccc1.
What is the InChIKey of 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one?
The InChIKey is SYWFVULUMHLCBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H22F3NO3/c1-29-21(16-17-12-14-20(15-13-17)32-25(26,27)28)24(30)31-23(19-10-6-3-7-11-19)22(29)18-8-4-2-5-9-18/h2-15,21-23H,16H2,1H3.
What are the key properties of 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one?
4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one has a molecular weight of 441.45 g/mol, XLogP of 5.47, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-5,6-diphenyl-3-[[4-(trifluoromethoxy)phenyl]methyl]morpholin-2-one is sourced from PubChem (CID 22949121), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).