C8H13N3O — CID 22949222
5-amino-3-ethyl-2,6-dimethylpyrimidin-4-one (PubChem CID 22949222) has the molecular formula C8H13N3O and a molecular weight of 167.21 g/mol. Its IUPAC name is 5-amino-3-ethyl-2,6-dimethylpyrimidin-4-one.
| Compound Name | 5-amino-3-ethyl-2,6-dimethylpyrimidin-4-one |
|---|---|
| PubChem CID | 22949222 |
| Molecular Formula | C8H13N3O |
| Molecular Weight | 167.21 g/mol |
| Exact Mass | 167.11 |
| IUPAC Name | 5-amino-3-ethyl-2,6-dimethylpyrimidin-4-one |
| SMILES | CCn1c(C)nc(C)c(N)c1=O |
| InChI | InChI=1S/C8H13N3O/c1-4-11-6(3)10-5(2)7(9)8(11)12/h4,9H2,1-3H3 |
| InChIKey | ROODJGHWZCRRLO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 60.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |