C56H96N2O8 — CID 22949682
[11-[8-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]octyl]-10-octylicosyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate (PubChem CID 22949682) has the molecular formula C56H96N2O8 and a molecular weight of 925.39 g/mol. Its IUPAC name is [11-[8-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]octyl]-10-octylicosyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate.
| Compound Name | [11-[8-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]octyl]-10-octylicosyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
|---|---|
| PubChem CID | 22949682 |
| Molecular Formula | C56H96N2O8 |
| Molecular Weight | 925.39 g/mol |
| Exact Mass | 924.72 |
| IUPAC Name | [11-[8-[6-(2,5-dioxopyrrol-1-yl)hexanoyloxy]octyl]-10-octylicosyl] 6-(2,5-dioxopyrrol-1-yl)hexanoate |
| SMILES | CCCCCCCCCC(CCCCCCCCOC(=O)CCCCCN1C(=O)C=CC1=O)C(CCCCCCCC)CCCCCCCCCOC(=O)CCCCCN1C(=O)C=CC1=O |
| InChI | InChI=1S/C56H96N2O8/c1-3-5-7-9-12-18-26-36-50(38-28-20-14-16-22-34-48-66-56(64)40-30-24-32-46-58-53(61)43-44-54(58)62)49(35-25-17-10-8-6-4-2)37-27-19-13-11-15-21-33-47-65-55(63)39-29-23-31-45-57-51(59)41-42-52(57)60/h41-44,49-50H,3-40,45-48H2,1-2H3 |
| InChIKey | NGUQNEUPDGSXME-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 127.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 47 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 925.39 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|