About (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one
(5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one (PubChem CID 22949805) has the molecular formula C15H32O3Si
and a molecular weight of 288.50 g/mol. Its IUPAC name is (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one.
Molecular Properties
| Compound Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one |
| PubChem CID | 22949805 |
| Molecular Formula | C15H32O3Si |
| Molecular Weight | 288.50 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one |
| SMILES | CCC(=O)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H32O3Si/c1-9-12(17)15(5,6)13(10-11-16)18-19(7,8)14(2,3)4/h13,16H,9-11H2,1-8H3/t13-/m0/s1 |
| InChIKey | MJXPGHJBTOTXLV-ZDUSSCGKSA-N |
| XLogP | 3.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.50 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one?
The IUPAC name of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one (CID 22949805) is (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one.
What is the SMILES notation for (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one?
The canonical SMILES for (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one is CCC(=O)C(C)(C)[C@H](CCO)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one?
The InChIKey is MJXPGHJBTOTXLV-ZDUSSCGKSA-N. The full InChI is InChI=1S/C15H32O3Si/c1-9-12(17)15(5,6)13(10-11-16)18-19(7,8)14(2,3)4/h13,16H,9-11H2,1-8H3/t13-/m0/s1.
What are the key properties of (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one?
(5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one has a molecular weight of 288.50 g/mol, XLogP of 3.76, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[tert-butyl(dimethyl)silyl]oxy-7-hydroxy-4,4-dimethylheptan-3-one is sourced from PubChem (CID 22949805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).