About 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one
4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one (PubChem CID 22949918) has the molecular formula C27H27F3O5S
and a molecular weight of 520.57 g/mol. Its IUPAC name is 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one.
Molecular Properties
| Compound Name | 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one |
| PubChem CID | 22949918 |
| Molecular Formula | C27H27F3O5S |
| Molecular Weight | 520.57 g/mol |
| Exact Mass | 520.15 |
| IUPAC Name | 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one |
| SMILES | O=C(CCc1ccc(OCCS(=O)(=O)CCOC(c2ccccc2)c2ccccc2)cc1)C(F)(F)F |
| InChI | InChI=1S/C27H27F3O5S/c28-27(29,30)25(31)16-13-21-11-14-24(15-12-21)34-17-19-36(32,33)20-18-35-26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,14-15,26H,13,16-20H2 |
| InChIKey | CQIZRCFUHAQOFW-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 520.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one?
The IUPAC name of 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one (CID 22949918) is 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one.
What is the SMILES notation for 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one?
The canonical SMILES for 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one is O=C(CCc1ccc(OCCS(=O)(=O)CCOC(c2ccccc2)c2ccccc2)cc1)C(F)(F)F.
What is the InChIKey of 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one?
The InChIKey is CQIZRCFUHAQOFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H27F3O5S/c28-27(29,30)25(31)16-13-21-11-14-24(15-12-21)34-17-19-36(32,33)20-18-35-26(22-7-3-1-4-8-22)23-9-5-2-6-10-23/h1-12,14-15,26H,13,16-20H2.
What are the key properties of 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one?
4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one has a molecular weight of 520.57 g/mol, XLogP of 5.35, 13 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[4-[2-(2-benzhydryloxyethylsulfonyl)ethoxy]phenyl]-1,1,1-trifluorobutan-2-one is sourced from PubChem (CID 22949918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).