C21H28N3O+ — CID 22950256
3-[4-[(E)-3-(2,3-dihydro-1,3-benzoxazol-2-yl)prop-2-enylidene]-1-pyridinyl]propyl-trimethylazanium (PubChem CID 22950256) has the molecular formula C21H28N3O+ and a molecular weight of 338.48 g/mol. Its IUPAC name is 3-[4-[(E)-3-(2,3-dihydro-1,3-benzoxazol-2-yl)prop-2-enylidene]-1-pyridinyl]propyl-trimethylazanium.
| Compound Name | 3-[4-[(E)-3-(2,3-dihydro-1,3-benzoxazol-2-yl)prop-2-enylidene]-1-pyridinyl]propyl-trimethylazanium |
|---|---|
| PubChem CID | 22950256 |
| Molecular Formula | C21H28N3O+ |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.22 |
| IUPAC Name | 3-[4-[(E)-3-(2,3-dihydro-1,3-benzoxazol-2-yl)prop-2-enylidene]-1-pyridinyl]propyl-trimethylazanium |
| SMILES | C[N+](C)(C)CCCN1C=CC(=C/C=C/C2Nc3ccccc3O2)C=C1 |
| InChI | InChI=1S/C21H28N3O/c1-24(2,3)17-7-14-23-15-12-18(13-16-23)8-6-11-21-22-19-9-4-5-10-20(19)25-21/h4-6,8-13,15-16,21-22H,7,14,17H2,1-3H3/q+1/b11-6+ |
| InChIKey | PHSVIZZQBQTKJF-IZZDOVSWSA-N |
| XLogP | 3.74 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|