C32H34N2O5S — CID 22950649
N-[5-(4-butan-2-ylphenoxy)-2-hydroxy-4-[(3-methylphenyl)sulfonylmethylamino]phenyl]-4-methylbenzamide (PubChem CID 22950649) has the molecular formula C32H34N2O5S and a molecular weight of 558.70 g/mol. Its IUPAC name is N-[5-(4-butan-2-ylphenoxy)-2-hydroxy-4-[(3-methylphenyl)sulfonylmethylamino]phenyl]-4-methylbenzamide.
| Compound Name | N-[5-(4-butan-2-ylphenoxy)-2-hydroxy-4-[(3-methylphenyl)sulfonylmethylamino]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 22950649 |
| Molecular Formula | C32H34N2O5S |
| Molecular Weight | 558.70 g/mol |
| Exact Mass | 558.22 |
| IUPAC Name | N-[5-(4-butan-2-ylphenoxy)-2-hydroxy-4-[(3-methylphenyl)sulfonylmethylamino]phenyl]-4-methylbenzamide |
| SMILES | CCC(C)c1ccc(Oc2cc(NC(=O)c3ccc(C)cc3)c(O)cc2NCS(=O)(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C32H34N2O5S/c1-5-23(4)24-13-15-26(16-14-24)39-31-19-28(34-32(36)25-11-9-21(2)10-12-25)30(35)18-29(31)33-20-40(37,38)27-8-6-7-22(3)17-27/h6-19,23,33,35H,5,20H2,1-4H3,(H,34,36) |
| InChIKey | KORSJRPFNSRKDX-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 104.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.70 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|