C9H17N — CID 22950918
(5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine (PubChem CID 22950918) has the molecular formula C9H17N and a molecular weight of 139.24 g/mol. Its IUPAC name is (5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine.
| Compound Name | (5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine |
|---|---|
| PubChem CID | 22950918 |
| Molecular Formula | C9H17N |
| Molecular Weight | 139.24 g/mol |
| Exact Mass | 139.14 |
| IUPAC Name | (5Z)-1,5-dimethyl-3,4,7,8-tetrahydro-2H-azocine |
| SMILES | C/C1=C/CCN(C)CCC1 |
| InChI | InChI=1S/C9H17N/c1-9-5-3-7-10(2)8-4-6-9/h5H,3-4,6-8H2,1-2H3/b9-5- |
| InChIKey | HLAMIYWLTOBEJO-UITAMQMPSA-N |
| XLogP | 2.05 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|