About 2,4-dichloro-5,6-diethylpyrimidine
2,4-dichloro-5,6-diethylpyrimidine (PubChem CID 22951070) has the molecular formula C8H10Cl2N2
and a molecular weight of 205.09 g/mol. Its IUPAC name is 2,4-dichloro-5,6-diethylpyrimidine.
Molecular Properties
| Compound Name | 2,4-dichloro-5,6-diethylpyrimidine |
| PubChem CID | 22951070 |
| Molecular Formula | C8H10Cl2N2 |
| Molecular Weight | 205.09 g/mol |
| Exact Mass | 204.02 |
| IUPAC Name | 2,4-dichloro-5,6-diethylpyrimidine |
| SMILES | CCc1nc(Cl)nc(Cl)c1CC |
| InChI | InChI=1S/C8H10Cl2N2/c1-3-5-6(4-2)11-8(10)12-7(5)9/h3-4H2,1-2H3 |
| InChIKey | LZOCIWXSTVWIFG-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.09 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2,4-dichloro-5,6-diethylpyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-dichloro-5,6-diethylpyrimidine?
The IUPAC name of 2,4-dichloro-5,6-diethylpyrimidine (CID 22951070) is 2,4-dichloro-5,6-diethylpyrimidine.
What is the SMILES notation for 2,4-dichloro-5,6-diethylpyrimidine?
The canonical SMILES for 2,4-dichloro-5,6-diethylpyrimidine is CCc1nc(Cl)nc(Cl)c1CC.
What is the InChIKey of 2,4-dichloro-5,6-diethylpyrimidine?
The InChIKey is LZOCIWXSTVWIFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10Cl2N2/c1-3-5-6(4-2)11-8(10)12-7(5)9/h3-4H2,1-2H3.
What are the key properties of 2,4-dichloro-5,6-diethylpyrimidine?
2,4-dichloro-5,6-diethylpyrimidine has a molecular weight of 205.09 g/mol, XLogP of 2.91, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-dichloro-5,6-diethylpyrimidine is sourced from PubChem (CID 22951070), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).