About 4-propan-2-ylpyridazine
4-propan-2-ylpyridazine (PubChem CID 22951092) has the molecular formula C7H10N2
and a molecular weight of 122.17 g/mol. Its IUPAC name is 4-propan-2-ylpyridazine.
Molecular Properties
| Compound Name | 4-propan-2-ylpyridazine |
| PubChem CID | 22951092 |
| Molecular Formula | C7H10N2 |
| Molecular Weight | 122.17 g/mol |
| Exact Mass | 122.08 |
| IUPAC Name | 4-propan-2-ylpyridazine |
| SMILES | CC(C)c1ccnnc1 |
| InChI | InChI=1S/C7H10N2/c1-6(2)7-3-4-8-9-5-7/h3-6H,1-2H3 |
| InChIKey | NSEAYDGWTIYXIJ-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.17 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-propan-2-ylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-propan-2-ylpyridazine?
The IUPAC name of 4-propan-2-ylpyridazine (CID 22951092) is 4-propan-2-ylpyridazine.
What is the SMILES notation for 4-propan-2-ylpyridazine?
The canonical SMILES for 4-propan-2-ylpyridazine is CC(C)c1ccnnc1.
What is the InChIKey of 4-propan-2-ylpyridazine?
The InChIKey is NSEAYDGWTIYXIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2/c1-6(2)7-3-4-8-9-5-7/h3-6H,1-2H3.
What are the key properties of 4-propan-2-ylpyridazine?
4-propan-2-ylpyridazine has a molecular weight of 122.17 g/mol, XLogP of 1.60, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-propan-2-ylpyridazine is sourced from PubChem (CID 22951092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).