About (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione
(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione (PubChem CID 22951238) has the molecular formula C11H21NS2
and a molecular weight of 231.43 g/mol. Its IUPAC name is (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione |
| PubChem CID | 22951238 |
| Molecular Formula | C11H21NS2 |
| Molecular Weight | 231.43 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione |
| SMILES | CC(C)C[C@H]1CSC(=S)N1CC(C)C |
| InChI | InChI=1S/C11H21NS2/c1-8(2)5-10-7-14-11(13)12(10)6-9(3)4/h8-10H,5-7H2,1-4H3/t10-/m0/s1 |
| InChIKey | JKSAFVFFUSYUAC-JTQLQIEISA-N |
| XLogP | 3.39 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione?
The IUPAC name of (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione (CID 22951238) is (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione.
What is the SMILES notation for (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione?
The canonical SMILES for (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione is CC(C)C[C@H]1CSC(=S)N1CC(C)C.
What is the InChIKey of (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione?
The InChIKey is JKSAFVFFUSYUAC-JTQLQIEISA-N. The full InChI is InChI=1S/C11H21NS2/c1-8(2)5-10-7-14-11(13)12(10)6-9(3)4/h8-10H,5-7H2,1-4H3/t10-/m0/s1.
What are the key properties of (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione?
(4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione has a molecular weight of 231.43 g/mol, XLogP of 3.39, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-3,4-bis(2-methylpropyl)-1,3-thiazolidine-2-thione is sourced from PubChem (CID 22951238), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).