C23H34O9 — CID 22952250
methyl (1,9,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate (PubChem CID 22952250) has the molecular formula C23H34O9 and a molecular weight of 454.52 g/mol. Its IUPAC name is methyl (1,9,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate.
| Compound Name | methyl (1,9,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate |
|---|---|
| PubChem CID | 22952250 |
| Molecular Formula | C23H34O9 |
| Molecular Weight | 454.52 g/mol |
| Exact Mass | 454.22 |
| IUPAC Name | methyl (1,9,12,15-tetrahydroxy-2,10,14,17,17-pentamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate |
| SMILES | COC(=O)OC12COC1CC(O)C1(C)C(=O)C(O)C3=C(C)C(O)CC(O)(C(C)C21)C3(C)C |
| InChI | InChI=1S/C23H34O9/c1-10-12(24)8-23(29)11(2)17-21(5,18(27)16(26)15(10)20(23,3)4)13(25)7-14-22(17,9-31-14)32-19(28)30-6/h11-14,16-17,24-26,29H,7-9H2,1-6H3 |
| InChIKey | DZTWATKYAMLOCK-UHFFFAOYSA-N |
| XLogP | 0.71 |
| TPSA | 142.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.52 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|