C24H36AcO8 — CID 22952257
actinium;methyl (1,12,15-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate (PubChem CID 22952257) has the molecular formula C24H36AcO8 and a molecular weight of 679.54 g/mol. Its IUPAC name is actinium;methyl (1,12,15-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate.
| Compound Name | actinium;methyl (1,12,15-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate |
|---|---|
| PubChem CID | 22952257 |
| Molecular Formula | C24H36AcO8 |
| Molecular Weight | 679.54 g/mol |
| Exact Mass | 679.27 |
| IUPAC Name | actinium;methyl (1,12,15-trihydroxy-2,9,10,14,17,17-hexamethyl-11-oxo-6-oxatetracyclo[11.3.1.03,10.04,7]heptadec-13-en-4-yl) carbonate |
| SMILES | COC(=O)OC12COC1CC(C)C1(C)C(=O)C(O)C3=C(C)C(O)CC(O)(C(C)C21)C3(C)C.[Ac] |
| InChI | InChI=1S/C24H36O8.Ac/c1-11-8-15-23(10-31-15,32-20(28)30-7)18-13(3)24(29)9-14(25)12(2)16(21(24,4)5)17(26)19(27)22(11,18)6;/h11,13-15,17-18,25-26,29H,8-10H2,1-7H3; |
| InChIKey | JBTFEPIAQLGXHZ-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.54 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|