About CID 22952265
CID 22952265 (PubChem CID 22952265) has the molecular formula C28H45O6Si
and a molecular weight of 505.75 g/mol.
Molecular Properties
| Compound Name | CID 22952265 |
| PubChem CID | 22952265 |
| Molecular Formula | C28H45O6Si |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | — |
| SMILES | COC(=O)OC12COC1CC(C)C1(C)C(=O)C(C)C3=C(C)C(C)CC(O[Si](C)C)(C(C)C21)C3(C)C |
| InChI | InChI=1S/C28H45O6Si/c1-15-13-28(34-35(10)11)19(5)22-26(8,23(29)18(4)21(17(15)3)25(28,6)7)16(2)12-20-27(22,14-32-20)33-24(30)31-9/h15-16,18-20,22H,12-14H2,1-11H3 |
| InChIKey | SCIMJBPUWURRSH-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 22952265 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22952265?
The IUPAC name of CID 22952265 (CID 22952265) is not available.
What is the SMILES notation for CID 22952265?
The canonical SMILES for CID 22952265 is COC(=O)OC12COC1CC(C)C1(C)C(=O)C(C)C3=C(C)C(C)CC(O[Si](C)C)(C(C)C21)C3(C)C.
What is the InChIKey of CID 22952265?
The InChIKey is SCIMJBPUWURRSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H45O6Si/c1-15-13-28(34-35(10)11)19(5)22-26(8,23(29)18(4)21(17(15)3)25(28,6)7)16(2)12-20-27(22,14-32-20)33-24(30)31-9/h15-16,18-20,22H,12-14H2,1-11H3.
What are the key properties of CID 22952265?
CID 22952265 has a molecular weight of 505.75 g/mol, XLogP of 5.81, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22952265 is sourced from PubChem (CID 22952265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).