About actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate
actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate (PubChem CID 22952271) has the molecular formula C10H16AcO5
and a molecular weight of 443.23 g/mol. Its IUPAC name is actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate.
Molecular Properties
| Compound Name | actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate |
| PubChem CID | 22952271 |
| Molecular Formula | C10H16AcO5 |
| Molecular Weight | 443.23 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate |
| SMILES | COC(=O)CC1(O)CC(O)CC2OC21C.[Ac] |
| InChI | InChI=1S/C10H16O5.Ac/c1-9-7(15-9)3-6(11)4-10(9,13)5-8(12)14-2;/h6-7,11,13H,3-5H2,1-2H3; |
| InChIKey | JGWRHMPEEUXONK-UHFFFAOYSA-N |
| XLogP | -0.41 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 443.23 |
| LogP ≤ 5 | -0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate?
The IUPAC name of actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate (CID 22952271) is actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate.
What is the SMILES notation for actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate?
The canonical SMILES for actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate is COC(=O)CC1(O)CC(O)CC2OC21C.[Ac].
What is the InChIKey of actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate?
The InChIKey is JGWRHMPEEUXONK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O5.Ac/c1-9-7(15-9)3-6(11)4-10(9,13)5-8(12)14-2;/h6-7,11,13H,3-5H2,1-2H3;.
What are the key properties of actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate?
actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate has a molecular weight of 443.23 g/mol, XLogP of -0.41, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for actinium;methyl 2-(2,4-dihydroxy-1-methyl-7-oxabicyclo[4.1.0]heptan-2-yl)acetate is sourced from PubChem (CID 22952271), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).