About methylbenzene;yttrium(3+)
methylbenzene;yttrium(3+) (PubChem CID 22952606) has the molecular formula C14H14Y+
and a molecular weight of 271.17 g/mol. Its IUPAC name is methylbenzene;yttrium(3+).
Molecular Properties
| Compound Name | methylbenzene;yttrium(3+) |
| PubChem CID | 22952606 |
| Molecular Formula | C14H14Y+ |
| Molecular Weight | 271.17 g/mol |
| Exact Mass | 271.01 |
| IUPAC Name | methylbenzene;yttrium(3+) |
| SMILES | Cc1cc[c-]cc1.Cc1cc[c-]cc1.[Y+3] |
| InChI | InChI=1S/2C7H7.Y/c2*1-7-5-3-2-4-6-7;/h2*3-6H,1H3;/q2*-1;+3 |
| InChIKey | LSVSJDRJKSTLOY-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 271.17 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze methylbenzene;yttrium(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylbenzene;yttrium(3+)?
The IUPAC name of methylbenzene;yttrium(3+) (CID 22952606) is methylbenzene;yttrium(3+).
What is the SMILES notation for methylbenzene;yttrium(3+)?
The canonical SMILES for methylbenzene;yttrium(3+) is Cc1cc[c-]cc1.Cc1cc[c-]cc1.[Y+3].
What is the InChIKey of methylbenzene;yttrium(3+)?
The InChIKey is LSVSJDRJKSTLOY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H7.Y/c2*1-7-5-3-2-4-6-7;/h2*3-6H,1H3;/q2*-1;+3.
What are the key properties of methylbenzene;yttrium(3+)?
methylbenzene;yttrium(3+) has a molecular weight of 271.17 g/mol, XLogP of 3.59, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for methylbenzene;yttrium(3+) is sourced from PubChem (CID 22952606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).