C37H29Cl2N7O8S2 — CID 22952649
3,4-dichloro-N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylpropanoylamino]-5-[2-nitro-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]phenoxy]phenyl]benzamide (PubChem CID 22952649) has the molecular formula C37H29Cl2N7O8S2 and a molecular weight of 834.72 g/mol. Its IUPAC name is 3,4-dichloro-N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylpropanoylamino]-5-[2-nitro-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]phenoxy]phenyl]benzamide.
| Compound Name | 3,4-dichloro-N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylpropanoylamino]-5-[2-nitro-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]phenoxy]phenyl]benzamide |
|---|---|
| PubChem CID | 22952649 |
| Molecular Formula | C37H29Cl2N7O8S2 |
| Molecular Weight | 834.72 g/mol |
| Exact Mass | 833.09 |
| IUPAC Name | 3,4-dichloro-N-[2-hydroxy-4-[2-(4-methylphenyl)sulfonylpropanoylamino]-5-[2-nitro-4-[(1-phenyltetrazol-5-yl)sulfanylmethyl]phenoxy]phenyl]benzamide |
| SMILES | Cc1ccc(S(=O)(=O)C(C)C(=O)Nc2cc(O)c(NC(=O)c3ccc(Cl)c(Cl)c3)cc2Oc2ccc(CSc3nnnn3-c3ccccc3)cc2[N+](=O)[O-])cc1 |
| InChI | InChI=1S/C37H29Cl2N7O8S2/c1-21-8-12-26(13-9-21)56(52,53)22(2)35(48)41-30-18-32(47)29(40-36(49)24-11-14-27(38)28(39)17-24)19-34(30)54-33-15-10-23(16-31(33)46(50)51)20-55-37-42-43-44-45(37)25-6-4-3-5-7-25/h3-19,22,47H,20H2,1-2H3,(H,40,49)(H,41,48) |
| InChIKey | GOZAXDQQBMTHEA-UHFFFAOYSA-N |
| XLogP | 8.03 |
| TPSA | 208.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 834.72 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|