C15H20N+ — CID 22953136
1',2',5'-trimethylspiro[cyclopentane-1,3'-indol-1-ium] (PubChem CID 22953136) has the molecular formula C15H20N+ and a molecular weight of 214.33 g/mol. Its IUPAC name is 1',2',5'-trimethylspiro[cyclopentane-1,3'-indol-1-ium].
| Compound Name | 1',2',5'-trimethylspiro[cyclopentane-1,3'-indol-1-ium] |
|---|---|
| PubChem CID | 22953136 |
| Molecular Formula | C15H20N+ |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1',2',5'-trimethylspiro[cyclopentane-1,3'-indol-1-ium] |
| SMILES | CC1=[N+](C)c2ccc(C)cc2C12CCCC2 |
| InChI | InChI=1S/C15H20N/c1-11-6-7-14-13(10-11)15(8-4-5-9-15)12(2)16(14)3/h6-7,10H,4-5,8-9H2,1-3H3/q+1 |
| InChIKey | VAZPSFYYNFDIFS-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|